C32H28N3OPtSi- — CID 154590092
2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]-4,6-dimethylphenol;platinum (PubChem CID 154590092) has the molecular formula C32H28N3OPtSi- and a molecular weight of 693.76 g/mol. Its IUPAC name is 2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]-4,6-dimethylphenol;platinum.
| Compound Name | 2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]-4,6-dimethylphenol;platinum |
|---|---|
| PubChem CID | 154590092 |
| Molecular Formula | C32H28N3OPtSi- |
| Molecular Weight | 693.76 g/mol |
| Exact Mass | 693.17 |
| IUPAC Name | 2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]-4,6-dimethylphenol;platinum |
| SMILES | Cc1cc(C)c(O)c(-n2c3ccccc3c3ccc(-c4[c-]c([Si](C)(C)c5ccccn5)ccc4)nc32)c1.[Pt] |
| InChI | InChI=1S/C32H28N3OSi.Pt/c1-21-18-22(2)31(36)29(19-21)35-28-13-6-5-12-25(28)26-15-16-27(34-32(26)35)23-10-9-11-24(20-23)37(3,4)30-14-7-8-17-33-30;/h5-19,36H,1-4H3;/q-1; |
| InChIKey | UHXLPRPLCXPPSF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.76 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|