C36H36N3OPtSi- — CID 154590034
2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]-3,6-di(propan-2-yl)pyrido[2,3-b]indol-9-yl]phenol;platinum (PubChem CID 154590034) has the molecular formula C36H36N3OPtSi- and a molecular weight of 749.87 g/mol. Its IUPAC name is 2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]-3,6-di(propan-2-yl)pyrido[2,3-b]indol-9-yl]phenol;platinum.
| Compound Name | 2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]-3,6-di(propan-2-yl)pyrido[2,3-b]indol-9-yl]phenol;platinum |
|---|---|
| PubChem CID | 154590034 |
| Molecular Formula | C36H36N3OPtSi- |
| Molecular Weight | 749.87 g/mol |
| Exact Mass | 749.23 |
| IUPAC Name | 2-[2-[3-[dimethyl(pyridin-2-yl)silyl]benzene-2-id-1-yl]-3,6-di(propan-2-yl)pyrido[2,3-b]indol-9-yl]phenol;platinum |
| SMILES | CC(C)c1ccc2c(c1)c1cc(C(C)C)c(-c3[c-]c([Si](C)(C)c4ccccn4)ccc3)nc1n2-c1ccccc1O.[Pt] |
| InChI | InChI=1S/C36H36N3OSi.Pt/c1-23(2)25-17-18-31-29(21-25)30-22-28(24(3)4)35(38-36(30)39(31)32-14-7-8-15-33(32)40)26-12-11-13-27(20-26)41(5,6)34-16-9-10-19-37-34;/h7-19,21-24,40H,1-6H3;/q-1; |
| InChIKey | KMSUYZRKDRATEG-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.87 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|