C34H33N3OSi — CID 154590001
2-[2-[3-tert-butyl-5-[dimethyl(pyridin-2-yl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol (PubChem CID 154590001) has the molecular formula C34H33N3OSi and a molecular weight of 527.74 g/mol. Its IUPAC name is 2-[2-[3-tert-butyl-5-[dimethyl(pyridin-2-yl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol.
| Compound Name | 2-[2-[3-tert-butyl-5-[dimethyl(pyridin-2-yl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol |
|---|---|
| PubChem CID | 154590001 |
| Molecular Formula | C34H33N3OSi |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-[2-[3-tert-butyl-5-[dimethyl(pyridin-2-yl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2ccc3c4ccccc4n(-c4ccccc4O)c3n2)cc([Si](C)(C)c2ccccn2)c1 |
| InChI | InChI=1S/C34H33N3OSi/c1-34(2,3)24-20-23(21-25(22-24)39(4,5)32-16-10-11-19-35-32)28-18-17-27-26-12-6-7-13-29(26)37(33(27)36-28)30-14-8-9-15-31(30)38/h6-22,38H,1-5H3 |
| InChIKey | XBAQRLYIMDFKKR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|