C36H29N3OSi — CID 154590095
2-[2-[6-[dimethyl(phenyl)silyl]-4-phenyl-2-pyridinyl]pyrido[2,3-b]indol-9-yl]phenol (PubChem CID 154590095) has the molecular formula C36H29N3OSi and a molecular weight of 547.73 g/mol. Its IUPAC name is 2-[2-[6-[dimethyl(phenyl)silyl]-4-phenyl-2-pyridinyl]pyrido[2,3-b]indol-9-yl]phenol.
| Compound Name | 2-[2-[6-[dimethyl(phenyl)silyl]-4-phenyl-2-pyridinyl]pyrido[2,3-b]indol-9-yl]phenol |
|---|---|
| PubChem CID | 154590095 |
| Molecular Formula | C36H29N3OSi |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 2-[2-[6-[dimethyl(phenyl)silyl]-4-phenyl-2-pyridinyl]pyrido[2,3-b]indol-9-yl]phenol |
| SMILES | C[Si](C)(c1ccccc1)c1cc(-c2ccccc2)cc(-c2ccc3c4ccccc4n(-c4ccccc4O)c3n2)n1 |
| InChI | InChI=1S/C36H29N3OSi/c1-41(2,27-15-7-4-8-16-27)35-24-26(25-13-5-3-6-14-25)23-31(37-35)30-22-21-29-28-17-9-10-18-32(28)39(36(29)38-30)33-19-11-12-20-34(33)40/h3-24,40H,1-2H3 |
| InChIKey | FVDLMMQIHYPMRH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|