C48H53N3OSi — CID 154589860
2-[3,6-ditert-butyl-2-[3-tert-butyl-5-[dimethyl-(4-phenyl-2-pyridinyl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol (PubChem CID 154589860) has the molecular formula C48H53N3OSi and a molecular weight of 716.06 g/mol. Its IUPAC name is 2-[3,6-ditert-butyl-2-[3-tert-butyl-5-[dimethyl-(4-phenyl-2-pyridinyl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol.
| Compound Name | 2-[3,6-ditert-butyl-2-[3-tert-butyl-5-[dimethyl-(4-phenyl-2-pyridinyl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol |
|---|---|
| PubChem CID | 154589860 |
| Molecular Formula | C48H53N3OSi |
| Molecular Weight | 716.06 g/mol |
| Exact Mass | 715.40 |
| IUPAC Name | 2-[3,6-ditert-butyl-2-[3-tert-butyl-5-[dimethyl-(4-phenyl-2-pyridinyl)silyl]phenyl]pyrido[2,3-b]indol-9-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2nc3c(cc2C(C)(C)C)c2cc(C(C)(C)C)ccc2n3-c2ccccc2O)cc([Si](C)(C)c2cc(-c3ccccc3)ccn2)c1 |
| InChI | InChI=1S/C48H53N3OSi/c1-46(2,3)34-21-22-40-37(29-34)38-30-39(48(7,8)9)44(50-45(38)51(40)41-19-15-16-20-42(41)52)33-25-35(47(4,5)6)28-36(26-33)53(10,11)43-27-32(23-24-49-43)31-17-13-12-14-18-31/h12-30,52H,1-11H3 |
| InChIKey | MUVPVNOAMKBBOM-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.06 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|