C38H39N4OPt- — CID 162491808
2-[5-methyl-3-[3-[1-[2,4,6-tri(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]pyrazol-1-yl]phenol;platinum (PubChem CID 162491808) has the molecular formula C38H39N4OPt- and a molecular weight of 762.84 g/mol. Its IUPAC name is 2-[5-methyl-3-[3-[1-[2,4,6-tri(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]pyrazol-1-yl]phenol;platinum.
| Compound Name | 2-[5-methyl-3-[3-[1-[2,4,6-tri(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]pyrazol-1-yl]phenol;platinum |
|---|---|
| PubChem CID | 162491808 |
| Molecular Formula | C38H39N4OPt- |
| Molecular Weight | 762.84 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | 2-[5-methyl-3-[3-[1-[2,4,6-tri(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]pyrazol-1-yl]phenol;platinum |
| SMILES | Cc1cc(-c2[c-]c(-c3nc4ccccc4n3-c3c(C(C)C)cc(C(C)C)cc3C(C)C)ccc2)nn1-c1ccccc1O.[Pt] |
| InChI | InChI=1S/C38H39N4O.Pt/c1-23(2)29-21-30(24(3)4)37(31(22-29)25(5)6)41-34-16-9-8-15-32(34)39-38(41)28-14-12-13-27(20-28)33-19-26(7)42(40-33)35-17-10-11-18-36(35)43;/h8-19,21-25,43H,1-7H3;/q-1; |
| InChIKey | NPMTXDQYUWQMQG-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.84 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|