C50H48N4PtSi — CID 168730858
N-[3-[1-[2,6-di(propan-2-yl)-4-(trimethylsilylmethyl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-N-phenyl-3-quinolin-2-ylbenzene-2-id-1-amine;platinum(2+) (PubChem CID 168730858) has the molecular formula C50H48N4PtSi and a molecular weight of 928.13 g/mol. Its IUPAC name is N-[3-[1-[2,6-di(propan-2-yl)-4-(trimethylsilylmethyl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-N-phenyl-3-quinolin-2-ylbenzene-2-id-1-amine;platinum(2+).
| Compound Name | N-[3-[1-[2,6-di(propan-2-yl)-4-(trimethylsilylmethyl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-N-phenyl-3-quinolin-2-ylbenzene-2-id-1-amine;platinum(2+) |
|---|---|
| PubChem CID | 168730858 |
| Molecular Formula | C50H48N4PtSi |
| Molecular Weight | 928.13 g/mol |
| Exact Mass | 927.33 |
| IUPAC Name | N-[3-[1-[2,6-di(propan-2-yl)-4-(trimethylsilylmethyl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-N-phenyl-3-quinolin-2-ylbenzene-2-id-1-amine;platinum(2+) |
| SMILES | CC(C)c1cc(C[Si](C)(C)C)cc(C(C)C)c1-n1c(-c2[c-]c(N(c3[c-]c(-c4ccc5ccccc5n4)ccc3)c3ccccc3)ccc2)nc2ccccc21.[Pt+2] |
| InChI | InChI=1S/C50H48N4Si.Pt/c1-34(2)43-29-36(33-55(5,6)7)30-44(35(3)4)49(43)54-48-26-14-13-25-47(48)52-50(54)39-19-16-23-42(32-39)53(40-20-9-8-10-21-40)41-22-15-18-38(31-41)46-28-27-37-17-11-12-24-45(37)51-46;/h8-30,34-35H,33H2,1-7H3;/q-2;+2 |
| InChIKey | DKOZCDLZIYXZQN-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.13 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|