C75H61N5O2Pt — CID 176823768
CID 176823768 (PubChem CID 176823768) has the molecular formula C75H61N5O2Pt and a molecular weight of 1259.42 g/mol.
| Compound Name | CID 176823768 |
|---|---|
| PubChem CID | 176823768 |
| Molecular Formula | C75H61N5O2Pt |
| Molecular Weight | 1259.42 g/mol |
| Exact Mass | 1258.45 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]c(Oc3[c-]c(-c4nc5ccccc5n4-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)c4oc5cc6cc7ccccc7cc6nc5c4c3)ccc2)nc2ccccc21.[Pt+2] |
| InChI | InChI=1S/C75H61N5O2.Pt/c1-44(2)58-36-53(48-22-11-9-12-23-48)37-59(45(3)4)71(58)79-67-32-19-17-30-64(67)77-74(79)52-28-21-29-56(35-52)81-57-42-62-70-69(41-55-34-50-26-15-16-27-51(50)40-66(55)76-70)82-73(62)63(43-57)75-78-65-31-18-20-33-68(65)80(75)72-60(46(5)6)38-54(39-61(72)47(7)8)49-24-13-10-14-25-49;/h9-34,36-42,44-47H,1-8H3;/q-2;+2 |
| InChIKey | CDBVBJBVUWFDCQ-UHFFFAOYSA-N |
| XLogP | 20.52 |
| TPSA | 70.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1259.42 |
| LogP ≤ 5 | 20.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|