C38H38N2OSi — CID 176583988
trimethyl-[4-(2-naphtho[1,2-b][1]benzofuran-10-ylbenzimidazol-1-yl)-3,5-di(propan-2-yl)phenyl]silane (PubChem CID 176583988) has the molecular formula C38H38N2OSi and a molecular weight of 566.82 g/mol. Its IUPAC name is trimethyl-[4-(2-naphtho[1,2-b][1]benzofuran-10-ylbenzimidazol-1-yl)-3,5-di(propan-2-yl)phenyl]silane.
| Compound Name | trimethyl-[4-(2-naphtho[1,2-b][1]benzofuran-10-ylbenzimidazol-1-yl)-3,5-di(propan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 176583988 |
| Molecular Formula | C38H38N2OSi |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | trimethyl-[4-(2-naphtho[1,2-b][1]benzofuran-10-ylbenzimidazol-1-yl)-3,5-di(propan-2-yl)phenyl]silane |
| SMILES | CC(C)c1cc([Si](C)(C)C)cc(C(C)C)c1-n1c(-c2cccc3c2oc2c4ccccc4ccc32)nc2ccccc21 |
| InChI | InChI=1S/C38H38N2OSi/c1-23(2)31-21-26(42(5,6)7)22-32(24(3)4)35(31)40-34-18-11-10-17-33(34)39-38(40)30-16-12-15-28-29-20-19-25-13-8-9-14-27(25)36(29)41-37(28)30/h8-24H,1-7H3 |
| InChIKey | CLYOHJDQMCNMEI-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|