C45H39N3OSi — CID 172542709
6-[1-[4-[methyl(diphenyl)silyl]-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile (PubChem CID 172542709) has the molecular formula C45H39N3OSi and a molecular weight of 665.91 g/mol. Its IUPAC name is 6-[1-[4-[methyl(diphenyl)silyl]-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile.
| Compound Name | 6-[1-[4-[methyl(diphenyl)silyl]-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 172542709 |
| Molecular Formula | C45H39N3OSi |
| Molecular Weight | 665.91 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 6-[1-[4-[methyl(diphenyl)silyl]-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile |
| SMILES | CC(C)c1cc([Si](C)(c2ccccc2)c2ccccc2)cc(C(C)C)c1-n1c(-c2cccc3c2oc2cc(C#N)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C45H39N3OSi/c1-29(2)38-26-34(50(5,32-15-8-6-9-16-32)33-17-10-7-11-18-33)27-39(30(3)4)43(38)48-41-22-13-12-21-40(41)47-45(48)37-20-14-19-36-35-24-23-31(28-46)25-42(35)49-44(36)37/h6-27,29-30H,1-5H3 |
| InChIKey | YJNXSGZULGSAJX-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.91 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|