C38H40N3OP — CID 172542795
6-[1-[4-di(propan-2-yl)phosphanyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile (PubChem CID 172542795) has the molecular formula C38H40N3OP and a molecular weight of 585.73 g/mol. Its IUPAC name is 6-[1-[4-di(propan-2-yl)phosphanyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile.
| Compound Name | 6-[1-[4-di(propan-2-yl)phosphanyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 172542795 |
| Molecular Formula | C38H40N3OP |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 6-[1-[4-di(propan-2-yl)phosphanyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-carbonitrile |
| SMILES | CC(C)c1cc(P(C(C)C)C(C)C)cc(C(C)C)c1-n1c(-c2cccc3c2oc2cc(C#N)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C38H40N3OP/c1-22(2)31-19-27(43(24(5)6)25(7)8)20-32(23(3)4)36(31)41-34-15-10-9-14-33(34)40-38(41)30-13-11-12-29-28-17-16-26(21-39)18-35(28)42-37(29)30/h9-20,22-25H,1-8H3 |
| InChIKey | NXYBFNWFYGPWCC-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|