C34H36N2OSi — CID 170931382
[6-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-yl]-trimethylsilane (PubChem CID 170931382) has the molecular formula C34H36N2OSi and a molecular weight of 516.76 g/mol. Its IUPAC name is [6-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-yl]-trimethylsilane.
| Compound Name | [6-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 170931382 |
| Molecular Formula | C34H36N2OSi |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | [6-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]dibenzofuran-3-yl]-trimethylsilane |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2cccc3c2oc2cc([Si](C)(C)C)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C34H36N2OSi/c1-21(2)24-12-10-13-25(22(3)4)32(24)36-30-17-9-8-16-29(30)35-34(36)28-15-11-14-27-26-19-18-23(38(5,6)7)20-31(26)37-33(27)28/h8-22H,1-7H3 |
| InChIKey | KUJSMNJSWUGFCR-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|