C46H42F2N2OSi — CID 169299507
[4-[2,6-difluoro-4-[2-(7-phenyldibenzofuran-4-yl)benzimidazol-1-yl]-3,5-di(propan-2-yl)phenyl]phenyl]-trimethylsilane (PubChem CID 169299507) has the molecular formula C46H42F2N2OSi and a molecular weight of 704.94 g/mol. Its IUPAC name is [4-[2,6-difluoro-4-[2-(7-phenyldibenzofuran-4-yl)benzimidazol-1-yl]-3,5-di(propan-2-yl)phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[2,6-difluoro-4-[2-(7-phenyldibenzofuran-4-yl)benzimidazol-1-yl]-3,5-di(propan-2-yl)phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 169299507 |
| Molecular Formula | C46H42F2N2OSi |
| Molecular Weight | 704.94 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | [4-[2,6-difluoro-4-[2-(7-phenyldibenzofuran-4-yl)benzimidazol-1-yl]-3,5-di(propan-2-yl)phenyl]phenyl]-trimethylsilane |
| SMILES | CC(C)c1c(F)c(-c2ccc([Si](C)(C)C)cc2)c(F)c(C(C)C)c1-n1c(-c2cccc3c2oc2cc(-c4ccccc4)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C46H42F2N2OSi/c1-27(2)39-42(47)41(30-20-23-32(24-21-30)52(5,6)7)43(48)40(28(3)4)44(39)50-37-19-12-11-18-36(37)49-46(50)35-17-13-16-34-33-25-22-31(26-38(33)51-45(34)35)29-14-9-8-10-15-29/h8-28H,1-7H3 |
| InChIKey | GSEITCFHRALFOT-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.94 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|