C44H31F7N2O — CID 169301365
1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenyl]dibenzofuran-4-yl]benzimidazole (PubChem CID 169301365) has the molecular formula C44H31F7N2O and a molecular weight of 736.73 g/mol. Its IUPAC name is 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenyl]dibenzofuran-4-yl]benzimidazole.
| Compound Name | 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenyl]dibenzofuran-4-yl]benzimidazole |
|---|---|
| PubChem CID | 169301365 |
| Molecular Formula | C44H31F7N2O |
| Molecular Weight | 736.73 g/mol |
| Exact Mass | 736.23 |
| IUPAC Name | 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenyl]dibenzofuran-4-yl]benzimidazole |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2cccc3c2oc2cc(-c4c(F)c(F)c(F)c(C(F)(F)F)c4F)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C44H31F7N2O/c1-22(2)30-19-26(24-11-6-5-7-12-24)20-31(23(3)4)41(30)53-33-16-9-8-15-32(33)52-43(53)29-14-10-13-28-27-18-17-25(21-34(27)54-42(28)29)35-37(45)36(44(49,50)51)39(47)40(48)38(35)46/h5-23H,1-4H3 |
| InChIKey | XTUCEVXBQCMYBS-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.73 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|