C60H57BN3OPt- — CID 176796273
2-[4-bis(2,4,6-trimethylphenyl)boranyl-6-[3-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 176796273) has the molecular formula C60H57BN3OPt- and a molecular weight of 1042.03 g/mol. Its IUPAC name is 2-[4-bis(2,4,6-trimethylphenyl)boranyl-6-[3-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-bis(2,4,6-trimethylphenyl)boranyl-6-[3-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 176796273 |
| Molecular Formula | C60H57BN3OPt- |
| Molecular Weight | 1042.03 g/mol |
| Exact Mass | 1041.42 |
| IUPAC Name | 2-[4-bis(2,4,6-trimethylphenyl)boranyl-6-[3-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Cc1cc(C)c(B(c2cc(-c3[c-]c(-c4nc5ccccc5n4-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)ccc3)nc(-c3ccccc3O)c2)c2c(C)cc(C)cc2C)c(C)c1.[Pt] |
| InChI | InChI=1S/C60H57BN3O.Pt/c1-36(2)50-32-47(44-19-12-11-13-20-44)33-51(37(3)4)59(50)64-55-25-16-15-24-52(55)63-60(64)46-22-18-21-45(31-46)53-34-48(35-54(62-53)49-23-14-17-26-56(49)65)61(57-40(7)27-38(5)28-41(57)8)58-42(9)29-39(6)30-43(58)10;/h11-30,32-37,65H,1-10H3;/q-1; |
| InChIKey | GLEVJKCQBNRSGM-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.03 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|