C42H37N4OPt- — CID 164823548
4-tert-butyl-2-[9-(4-tert-butyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)pyrido[2,3-b]indol-2-yl]phenol;platinum (PubChem CID 164823548) has the molecular formula C42H37N4OPt- and a molecular weight of 808.86 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-(4-tert-butyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)pyrido[2,3-b]indol-2-yl]phenol;platinum.
| Compound Name | 4-tert-butyl-2-[9-(4-tert-butyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)pyrido[2,3-b]indol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164823548 |
| Molecular Formula | C42H37N4OPt- |
| Molecular Weight | 808.86 g/mol |
| Exact Mass | 808.26 |
| IUPAC Name | 4-tert-butyl-2-[9-(4-tert-butyl-9-pyridin-2-yl-1H-carbazol-1-id-2-yl)pyrido[2,3-b]indol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(O)c(-c2ccc3c4ccccc4n(-c4[c-]c5c(c(C(C)(C)C)c4)c4ccccc4n5-c4ccccn4)c3n2)c1.[Pt] |
| InChI | InChI=1S/C42H37N4O.Pt/c1-41(2,3)26-18-21-37(47)31(23-26)33-20-19-29-28-13-7-9-15-34(28)45(40(29)44-33)27-24-32(42(4,5)6)39-30-14-8-10-16-35(30)46(36(39)25-27)38-17-11-12-22-43-38;/h7-24,47H,1-6H3;/q-1; |
| InChIKey | FKRMVXHLDGNAOW-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.86 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|