C62H62N3OPt- — CID 176614220
2,4-ditert-butyl-6-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 176614220) has the molecular formula C62H62N3OPt- and a molecular weight of 1060.28 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 176614220 |
| Molecular Formula | C62H62N3OPt- |
| Molecular Weight | 1060.28 g/mol |
| Exact Mass | 1059.45 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-(3,5-ditert-butylphenyl)-6-[3-[4-(9-phenylcarbazol-1-yl)-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(-c4cc(-c5cccc6c7ccccc7n(-c7ccccc7)c56)ccn4)ccc3)nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C62H62N3O.Pt/c1-59(2,3)44-31-42(32-45(36-44)60(4,5)6)43-34-54(64-55(35-43)51-37-46(61(7,8)9)38-52(58(51)66)62(10,11)12)41-21-18-20-40(30-41)53-33-39(28-29-63-53)48-25-19-26-50-49-24-16-17-27-56(49)65(57(48)50)47-22-14-13-15-23-47;/h13-29,31-38,66H,1-12H3;/q-1; |
| InChIKey | OQAZMQHAHOTRHQ-UHFFFAOYSA-N |
| XLogP | 16.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.28 |
| LogP ≤ 5 | 16.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|