C43H44N5OPt+ — CID 168721362
2,4-ditert-butyl-6-[3-[2-[3-(4-tert-butyl-2-pyridinyl)-2H-pyrrolo[3,2-b]pyridin-2-id-1-yl]phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+) (PubChem CID 168721362) has the molecular formula C43H44N5OPt+ and a molecular weight of 841.94 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[2-[3-(4-tert-butyl-2-pyridinyl)-2H-pyrrolo[3,2-b]pyridin-2-id-1-yl]phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+).
| Compound Name | 2,4-ditert-butyl-6-[3-[2-[3-(4-tert-butyl-2-pyridinyl)-2H-pyrrolo[3,2-b]pyridin-2-id-1-yl]phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+) |
|---|---|
| PubChem CID | 168721362 |
| Molecular Formula | C43H44N5OPt+ |
| Molecular Weight | 841.94 g/mol |
| Exact Mass | 841.32 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[2-[3-(4-tert-butyl-2-pyridinyl)-2H-pyrrolo[3,2-b]pyridin-2-id-1-yl]phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]n(-c3ccccc3-[n+]3[c-]n(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)c4ccccc43)c3cccnc23)c1.[Pt+2] |
| InChI | InChI=1S/C43H44N5O.Pt/c1-41(2,3)28-20-22-44-32(24-28)30-26-46(37-19-14-21-45-39(30)37)33-15-10-11-16-34(33)47-27-48(36-18-13-12-17-35(36)47)38-25-29(42(4,5)6)23-31(40(38)49)43(7,8)9;/h10-25,49H,1-9H3;/q-1;+2 |
| InChIKey | VJBTYOJHJBIVHO-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.94 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|