C28H25N3O2Pt — CID 168730603
2-[4-tert-butyl-6-[3-(2-hydroxyphenyl)-2H-benzimidazol-1-ium-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 168730603) has the molecular formula C28H25N3O2Pt and a molecular weight of 630.61 g/mol. Its IUPAC name is 2-[4-tert-butyl-6-[3-(2-hydroxyphenyl)-2H-benzimidazol-1-ium-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-tert-butyl-6-[3-(2-hydroxyphenyl)-2H-benzimidazol-1-ium-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 168730603 |
| Molecular Formula | C28H25N3O2Pt |
| Molecular Weight | 630.61 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 2-[4-tert-butyl-6-[3-(2-hydroxyphenyl)-2H-benzimidazol-1-ium-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2ccccc2O)nc(-[n+]2[c-]n(-c3ccccc3O)c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C28H25N3O2.Pt/c1-28(2,3)19-16-21(20-10-4-8-14-25(20)32)29-27(17-19)31-18-30(22-11-5-6-12-23(22)31)24-13-7-9-15-26(24)33;/h4-17,32-33H,1-3H3; |
| InChIKey | PNTWCGIXOVCMPR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|