C46H35N5 — CID 165164158
10-[3-[3-(4-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene (PubChem CID 165164158) has the molecular formula C46H35N5 and a molecular weight of 657.82 g/mol. Its IUPAC name is 10-[3-[3-(4-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene.
| Compound Name | 10-[3-[3-(4-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 165164158 |
| Molecular Formula | C46H35N5 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 10-[3-[3-(4-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene |
| SMILES | CC(C)(C)c1ccc(-[n+]2[c-]n(-c3cccc(-n4c5ccccc5c5cc6c7ccccc7n(-c7ccccc7)c6nc54)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C46H35N5/c1-46(2,3)31-24-26-32(27-25-31)48-30-49(43-23-12-11-22-42(43)48)34-16-13-17-35(28-34)51-41-21-10-8-19-37(41)39-29-38-36-18-7-9-20-40(36)50(44(38)47-45(39)51)33-14-5-4-6-15-33/h4-29H,1-3H3 |
| InChIKey | PCCVOLZVXIRSEC-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 31.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|