C43H37N3O — CID 168831386
2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(3,4-dimethylphenyl)carbazole (PubChem CID 168831386) has the molecular formula C43H37N3O and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(3,4-dimethylphenyl)carbazole.
| Compound Name | 2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(3,4-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 168831386 |
| Molecular Formula | C43H37N3O |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(3,4-dimethylphenyl)carbazole |
| SMILES | Cc1ccc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6cccc(C(C)(C)C)c6)c6ccccc65)c4)cc32)cc1C |
| InChI | InChI=1S/C43H37N3O/c1-29-20-21-34(24-30(29)2)46-39-17-7-6-16-37(39)38-23-22-36(27-42(38)46)47-35-15-11-14-33(26-35)45-28-44(40-18-8-9-19-41(40)45)32-13-10-12-31(25-32)43(3,4)5/h6-27H,1-5H3 |
| InChIKey | CKTOPDJPXXZTAQ-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 22.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|