C30H21N3O — CID 168730622
2-[3-[6-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)-2-pyridinyl]phenyl]phenol (PubChem CID 168730622) has the molecular formula C30H21N3O and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[3-[6-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)-2-pyridinyl]phenyl]phenol.
| Compound Name | 2-[3-[6-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)-2-pyridinyl]phenyl]phenol |
|---|---|
| PubChem CID | 168730622 |
| Molecular Formula | C30H21N3O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[3-[6-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)-2-pyridinyl]phenyl]phenol |
| SMILES | Oc1ccccc1-c1cccc(-c2cccc(-n3[c-][n+](-c4ccccc4)c4ccccc43)n2)c1 |
| InChI | InChI=1S/C30H21N3O/c34-29-18-7-4-14-25(29)22-10-8-11-23(20-22)26-15-9-19-30(31-26)33-21-32(24-12-2-1-3-13-24)27-16-5-6-17-28(27)33/h1-20,34H |
| InChIKey | AFZGVVWZRRMBLZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|