C74H50N10 — CID 170521764
CID 170521764 (PubChem CID 170521764) has the molecular formula C74H50N10 and a molecular weight of 1079.28 g/mol.
| Compound Name | CID 170521764 |
|---|---|
| PubChem CID | 170521764 |
| Molecular Formula | C74H50N10 |
| Molecular Weight | 1079.28 g/mol |
| Exact Mass | 1078.42 |
| IUPAC Name | — |
| SMILES | Cc1cccc2c3cccc(C)c3n(-c3nc4cc(n3)-c3ccccc3-c3cc(nc(-n5c6c(C)cccc6c6cccc(C)c65)n3)-c3ccccc3-[n+]3[c-]n(c5ccccc53)-c3ccccc3-n3[c-][n+](c5ccccc53)-c3cccc-4c3)c12 |
| InChI | InChI=1S/C74H50N10/c1-45-20-15-29-53-54-30-16-21-46(2)70(54)83(69(45)53)73-75-58-41-59(76-73)51-26-5-6-27-52(51)60-42-61(78-74(77-60)84-71-47(3)22-17-31-55(71)56-32-18-23-48(4)72(56)84)57-28-7-8-33-62(57)80-44-82(66-37-12-11-36-65(66)80)68-39-14-13-38-67(68)81-43-79(50-25-19-24-49(58)40-50)63-34-9-10-35-64(63)81/h5-42H,1-4H3 |
| InChIKey | IPRIGPRDIKGHBL-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 79.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.28 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|