C36H24N3OPt+ — CID 168730623
2-[6-[3-[3-(2-phenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum(2+) (PubChem CID 168730623) has the molecular formula C36H24N3OPt+ and a molecular weight of 709.69 g/mol. Its IUPAC name is 2-[6-[3-[3-(2-phenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum(2+).
| Compound Name | 2-[6-[3-[3-(2-phenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum(2+) |
|---|---|
| PubChem CID | 168730623 |
| Molecular Formula | C36H24N3OPt+ |
| Molecular Weight | 709.69 g/mol |
| Exact Mass | 709.16 |
| IUPAC Name | 2-[6-[3-[3-(2-phenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum(2+) |
| SMILES | Oc1ccccc1-c1cccc(-c2[c-]c(-n3[c-][n+](-c4ccccc4-c4ccccc4)c4ccccc43)ccc2)n1.[Pt+2] |
| InChI | InChI=1S/C36H24N3O.Pt/c40-36-23-9-5-17-30(36)32-19-11-18-31(37-32)27-14-10-15-28(24-27)38-25-39(35-22-8-7-21-34(35)38)33-20-6-4-16-29(33)26-12-2-1-3-13-26;/h1-23,40H;/q-1;+2 |
| InChIKey | PJLKCBKYKZYYAI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|