C53H34N4OPt-2 — CID 154594807
1-(2,6-diphenylphenyl)-3-[3-[3-[6-(4-phenylphenyl)pyrimidin-4-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-ide;platinum (PubChem CID 154594807) has the molecular formula C53H34N4OPt-2 and a molecular weight of 937.96 g/mol. Its IUPAC name is 1-(2,6-diphenylphenyl)-3-[3-[3-[6-(4-phenylphenyl)pyrimidin-4-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-ide;platinum.
| Compound Name | 1-(2,6-diphenylphenyl)-3-[3-[3-[6-(4-phenylphenyl)pyrimidin-4-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-ide;platinum |
|---|---|
| PubChem CID | 154594807 |
| Molecular Formula | C53H34N4OPt-2 |
| Molecular Weight | 937.96 g/mol |
| Exact Mass | 937.24 |
| IUPAC Name | 1-(2,6-diphenylphenyl)-3-[3-[3-[6-(4-phenylphenyl)pyrimidin-4-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-ide;platinum |
| SMILES | [Pt].[c-]1c(Oc2[c-]c(-n3[c-][n+](-c4c(-c5ccccc5)cccc4-c4ccccc4)c4ccccc43)ccc2)cccc1-c1cc(-c2ccc(-c3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C53H34N4O.Pt/c1-4-15-38(16-5-1)39-29-31-42(32-30-39)49-35-50(55-36-54-49)43-21-12-23-45(33-43)58-46-24-13-22-44(34-46)56-37-57(52-28-11-10-27-51(52)56)53-47(40-17-6-2-7-18-40)25-14-26-48(53)41-19-8-3-9-20-41;/h1-32,35-36H;/q-2; |
| InChIKey | MYDHNFWKLRTQPC-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.96 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|