C46H26N8OPt-2 — CID 169309447
CID 169309447 (PubChem CID 169309447) has the molecular formula C46H26N8OPt-2 and a molecular weight of 901.85 g/mol.
| Compound Name | CID 169309447 |
|---|---|
| PubChem CID | 169309447 |
| Molecular Formula | C46H26N8OPt-2 |
| Molecular Weight | 901.85 g/mol |
| Exact Mass | 901.19 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)nc2n3c3nc4ccccc4n3c3nc4ccccc4n23)cccc1-n1[c-][n+](-c2ccccc2-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C46H26N8O.Pt/c1-2-13-30(14-3-1)34-17-4-7-20-38(34)51-29-50(41-23-10-11-24-42(41)51)31-15-12-16-32(27-31)55-33-25-26-37-43(28-33)54-45-48-36-19-6-9-22-40(36)52(45)44-47-35-18-5-8-21-39(35)53(44)46(54)49-37;/h1-26H;/q-2; |
| InChIKey | NJXMTAALYVUDSF-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.85 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|