C32H18N7O2Pt- — CID 169309414
CID 169309414 (PubChem CID 169309414) has the molecular formula C32H18N7O2Pt- and a molecular weight of 727.62 g/mol.
| Compound Name | CID 169309414 |
|---|---|
| PubChem CID | 169309414 |
| Molecular Formula | C32H18N7O2Pt- |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 727.12 |
| IUPAC Name | — |
| SMILES | Oc1ccccc1-c1cccc(Oc2[c-]c3c(cc2)nc2n3c3nc4ccccc4n3c3nc4ccccc4n23)n1.[Pt] |
| InChI | InChI=1S/C32H18N7O2.Pt/c40-28-14-6-1-8-20(28)21-11-7-15-29(33-21)41-19-16-17-24-27(18-19)39-31-35-23-10-3-5-13-26(23)37(31)30-34-22-9-2-4-12-25(22)38(30)32(39)36-24;/h1-17,40H;/q-1; |
| InChIKey | VSIHIOPUSCYVMV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|