C40H21N8OPt- — CID 169309483
CID 169309483 (PubChem CID 169309483) has the molecular formula C40H21N8OPt- and a molecular weight of 824.74 g/mol.
| Compound Name | CID 169309483 |
|---|---|
| PubChem CID | 169309483 |
| Molecular Formula | C40H21N8OPt- |
| Molecular Weight | 824.74 g/mol |
| Exact Mass | 824.15 |
| IUPAC Name | — |
| SMILES | Oc1cccc2nc3c4ccccc4n4c5cccc(-c6[c-]c7c(cc6)nc6c8ccccc8n8c9ccccc9nc8n76)c5nc4n3c12.[Pt] |
| InChI | InChI=1S/C40H21N8O.Pt/c49-34-18-8-13-28-36(34)48-38(42-28)25-10-2-5-15-30(25)46-32-17-7-11-23(35(32)44-40(46)48)22-19-20-27-33(21-22)47-37(41-27)24-9-1-4-14-29(24)45-31-16-6-3-12-26(31)43-39(45)47;/h1-20,49H;/q-1; |
| InChIKey | QFFJOPIFKRNDRM-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|