C43H42N5OPt- — CID 169309430
2,4-ditert-butyl-6-[3-tert-butyl-5-(2,4,9,17,24-pentazahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(24),3(8),4,6,9,11,13,15,18,20,22-undecaen-5-yl)benzene-6-id-1-yl]phenol;platinum (PubChem CID 169309430) has the molecular formula C43H42N5OPt- and a molecular weight of 839.92 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-tert-butyl-5-(2,4,9,17,24-pentazahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(24),3(8),4,6,9,11,13,15,18,20,22-undecaen-5-yl)benzene-6-id-1-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[3-tert-butyl-5-(2,4,9,17,24-pentazahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(24),3(8),4,6,9,11,13,15,18,20,22-undecaen-5-yl)benzene-6-id-1-yl]phenol;platinum |
|---|---|
| PubChem CID | 169309430 |
| Molecular Formula | C43H42N5OPt- |
| Molecular Weight | 839.92 g/mol |
| Exact Mass | 839.30 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-tert-butyl-5-(2,4,9,17,24-pentazahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(24),3(8),4,6,9,11,13,15,18,20,22-undecaen-5-yl)benzene-6-id-1-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2ccc3nc4c5ccccc5n5c6ccccc6nc5n4c3n2)[c-]c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c1.[Pt] |
| InChI | InChI=1S/C43H42N5O.Pt/c1-41(2,3)27-21-25(30-23-28(42(4,5)6)24-31(37(30)49)43(7,8)9)20-26(22-27)32-18-19-34-39(44-32)48-38(45-34)29-14-10-12-16-35(29)47-36-17-13-11-15-33(36)46-40(47)48;/h10-19,21-24,49H,1-9H3;/q-1; |
| InChIKey | WKNYITOYUWKPRZ-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 67.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.92 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|