C54H52N3O2Pt- — CID 171057378
2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(4-hydroxy-2-phenylphenyl)benzimidazol-2-yl]phenol;platinum (PubChem CID 171057378) has the molecular formula C54H52N3O2Pt- and a molecular weight of 970.11 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(4-hydroxy-2-phenylphenyl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(4-hydroxy-2-phenylphenyl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 171057378 |
| Molecular Formula | C54H52N3O2Pt- |
| Molecular Weight | 970.11 g/mol |
| Exact Mass | 969.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(4-hydroxy-2-phenylphenyl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)ccn2)[c-]c(-c2cccc3c2nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n3-c2ccc(O)cc2-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C54H52N3O2.Pt/c1-52(2,3)39-28-37(27-38(29-39)46-30-36(25-26-55-46)34-17-12-10-13-18-34)42-21-16-22-48-49(42)56-51(44-31-40(53(4,5)6)32-45(50(44)59)54(7,8)9)57(48)47-24-23-41(58)33-43(47)35-19-14-11-15-20-35;/h10-26,28-33,58-59H,1-9H3;/q-1; |
| InChIKey | FCKSHXGPNZAKGO-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.11 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|