C58H60N3OPt- — CID 153481343
2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 153481343) has the molecular formula C58H60N3OPt- and a molecular weight of 1010.22 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153481343 |
| Molecular Formula | C58H60N3OPt- |
| Molecular Weight | 1010.22 g/mol |
| Exact Mass | 1009.44 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)ccn2)[c-]c(-c2cccc3c2nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n3-c2ccc(C(C)(C)C)cc2-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C58H60N3O.Pt/c1-55(2,3)42-26-27-50(46(34-42)38-22-17-14-18-23-38)61-51-25-19-24-45(52(51)60-54(61)47-35-44(57(7,8)9)36-48(53(47)62)58(10,11)12)40-30-41(32-43(31-40)56(4,5)6)49-33-39(28-29-59-49)37-20-15-13-16-21-37;/h13-29,31-36,62H,1-12H3;/q-1; |
| InChIKey | QEQGXQMTDYVVCO-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.22 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|