C60H56N3OPt- — CID 167355310
2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-(4-phenylphenyl)-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 167355310) has the molecular formula C60H56N3OPt- and a molecular weight of 1030.21 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-(4-phenylphenyl)-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-(4-phenylphenyl)-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 167355310 |
| Molecular Formula | C60H56N3OPt- |
| Molecular Weight | 1030.21 g/mol |
| Exact Mass | 1029.41 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-(4-phenylphenyl)-2-pyridinyl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c(-c4[c-]c(-c5cc(-c6ccc(-c7ccccc7)cc6)ccn5)ccc4)cccc32)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C60H56N3O.Pt/c1-58(2,3)46-30-31-53(49(36-46)42-20-14-11-15-21-42)63-54-25-17-24-48(55(54)62-57(63)50-37-47(59(4,5)6)38-51(56(50)64)60(7,8)9)44-22-16-23-45(34-44)52-35-43(32-33-61-52)41-28-26-40(27-29-41)39-18-12-10-13-19-39;/h10-33,35-38,64H,1-9H3;/q-1; |
| InChIKey | VQTBLJVSKJGKGT-UHFFFAOYSA-N |
| XLogP | 15.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.21 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|