C53H50N3OPt- — CID 164742817
2,4-ditert-butyl-6-[1-phenyl-4-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-pyridin-2-ylbenzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 164742817) has the molecular formula C53H50N3OPt- and a molecular weight of 940.08 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-phenyl-4-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-pyridin-2-ylbenzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-phenyl-4-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-pyridin-2-ylbenzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164742817 |
| Molecular Formula | C53H50N3OPt- |
| Molecular Weight | 940.08 g/mol |
| Exact Mass | 939.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-phenyl-4-[3-[4-(2-phenylpropan-2-yl)phenyl]-5-pyridin-2-ylbenzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc3c(-c4[c-]c(-c5ccccn5)cc(-c5ccc(C(C)(C)c6ccccc6)cc5)c4)cccc3n2-c2ccccc2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C53H50N3O.Pt/c1-51(2,3)41-33-44(49(57)45(34-41)52(4,5)6)50-55-48-43(22-17-24-47(48)56(50)42-20-13-10-14-21-42)37-30-36(31-38(32-37)46-23-15-16-29-54-46)35-25-27-40(28-26-35)53(7,8)39-18-11-9-12-19-39;/h9-31,33-34,57H,1-8H3;/q-1; |
| InChIKey | JMVZTURKZDTOBW-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.08 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|