C47H46N3OPt- — CID 164742580
2,4-ditert-butyl-6-[1-phenyl-7-(2-phenylpropan-2-yl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]phenol;platinum (PubChem CID 164742580) has the molecular formula C47H46N3OPt- and a molecular weight of 863.98 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-phenyl-7-(2-phenylpropan-2-yl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-phenyl-7-(2-phenylpropan-2-yl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164742580 |
| Molecular Formula | C47H46N3OPt- |
| Molecular Weight | 863.98 g/mol |
| Exact Mass | 863.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-phenyl-7-(2-phenylpropan-2-yl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc3c(-c4[c-]c(-c5ccccn5)ccc4)ccc(C(C)(C)c4ccccc4)c3n2-c2ccccc2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C47H46N3O.Pt/c1-45(2,3)34-29-37(43(51)39(30-34)46(4,5)6)44-49-41-36(31-18-17-19-32(28-31)40-24-15-16-27-48-40)25-26-38(47(7,8)33-20-11-9-12-21-33)42(41)50(44)35-22-13-10-14-23-35;/h9-27,29-30,51H,1-8H3;/q-1; |
| InChIKey | FQHBMKWCLXMSMV-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.98 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|