C62H51N4OPt- — CID 162784220
2,4-ditert-butyl-6-[1-(2-phenylphenyl)-4-[3-phenyl-5-(5-phenylpyrido[4,3-b]indol-1-yl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 162784220) has the molecular formula C62H51N4OPt- and a molecular weight of 1063.19 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(2-phenylphenyl)-4-[3-phenyl-5-(5-phenylpyrido[4,3-b]indol-1-yl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-(2-phenylphenyl)-4-[3-phenyl-5-(5-phenylpyrido[4,3-b]indol-1-yl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 162784220 |
| Molecular Formula | C62H51N4OPt- |
| Molecular Weight | 1063.19 g/mol |
| Exact Mass | 1062.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(2-phenylphenyl)-4-[3-phenyl-5-(5-phenylpyrido[4,3-b]indol-1-yl)benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc3c(-c4[c-]c(-c5nccc6c5c5ccccc5n6-c5ccccc5)cc(-c5ccccc5)c4)cccc3n2-c2ccccc2-c2ccccc2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C62H51N4O.Pt/c1-61(2,3)45-38-50(59(67)51(39-45)62(4,5)6)60-64-58-48(29-20-32-55(58)66(60)52-30-18-16-27-47(52)41-23-12-8-13-24-41)43-35-42(40-21-10-7-11-22-40)36-44(37-43)57-56-49-28-17-19-31-53(49)65(54(56)33-34-63-57)46-25-14-9-15-26-46;/h7-36,38-39,67H,1-6H3;/q-1; |
| InChIKey | YXRJFRRWJHJYKT-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.19 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|