C58H59N4OPt- — CID 164823625
2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 164823625) has the molecular formula C58H59N4OPt- and a molecular weight of 1023.21 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164823625 |
| Molecular Formula | C58H59N4OPt- |
| Molecular Weight | 1023.21 g/mol |
| Exact Mass | 1022.43 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(-c4cccc5c4nc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)n5-c4ccc(C(C)(C)C)cc4-c4ccccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C58H59N4O.Pt/c1-55(2,3)38-26-28-48(44(32-38)36-19-14-13-15-20-36)62-49-24-18-22-41(52(49)60-54(62)45-33-40(57(7,8)9)34-46(53(45)63)58(10,11)12)37-25-27-43-42-21-16-17-23-47(42)61(50(43)31-37)51-35-39(29-30-59-51)56(4,5)6;/h13-30,32-35,63H,1-12H3;/q-1; |
| InChIKey | WYZGYPHQUPVENG-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.21 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|