C55H51N4OPt- — CID 177095948
CID 177095948 (PubChem CID 177095948) has the molecular formula C55H51N4OPt- and a molecular weight of 979.12 g/mol.
| Compound Name | CID 177095948 |
|---|---|
| PubChem CID | 177095948 |
| Molecular Formula | C55H51N4OPt- |
| Molecular Weight | 979.12 g/mol |
| Exact Mass | 978.37 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cccc3c2nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n3-c2ccc(C(C)(C)C)cc2-c2ccccc2)[c-]c2c1c1cccc3cc4ccnc2n4c31.[Pt] |
| InChI | InChI=1S/C55H51N4O.Pt/c1-32-26-35(28-42-47(32)40-20-14-18-34-27-38-24-25-56-51(42)58(38)49(34)40)39-19-15-21-46-48(39)57-52(43-30-37(54(5,6)7)31-44(50(43)60)55(8,9)10)59(46)45-23-22-36(53(2,3)4)29-41(45)33-16-12-11-13-17-33;/h11-27,29-31,60H,1-10H3;/q-1; |
| InChIKey | YJIUHUKOQCKNHM-UHFFFAOYSA-N |
| XLogP | 14.28 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.12 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|