C60H59N4OPt- — CID 172504627
CID 172504627 (PubChem CID 172504627) has the molecular formula C60H59N4OPt- and a molecular weight of 1047.24 g/mol.
| Compound Name | CID 172504627 |
|---|---|
| PubChem CID | 172504627 |
| Molecular Formula | C60H59N4OPt- |
| Molecular Weight | 1047.24 g/mol |
| Exact Mass | 1046.43 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c(-c4[c-]c5c(cc4)C4CCCCC4c4cccc6c7cccnc7n-5c46)cccc32)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C60H59N4O.Pt/c1-58(2,3)38-28-30-50(47(33-38)36-18-11-10-12-19-36)63-51-26-16-22-40(53(51)62-57(63)48-34-39(59(4,5)6)35-49(55(48)65)60(7,8)9)37-27-29-43-41-20-13-14-21-42(41)44-23-15-24-45-46-25-17-31-61-56(46)64(54(44)45)52(43)32-37;/h10-12,15-19,22-31,33-35,41-42,65H,13-14,20-21H2,1-9H3;/q-1; |
| InChIKey | XXGSEQKAKXMXLY-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.24 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|