C54H50N3O2Pt- — CID 162783419
2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-pyridin-2-yl-2H-dibenzofuran-2-id-1-yl)benzimidazol-2-yl]phenol;platinum (PubChem CID 162783419) has the molecular formula C54H50N3O2Pt- and a molecular weight of 968.09 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-pyridin-2-yl-2H-dibenzofuran-2-id-1-yl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-pyridin-2-yl-2H-dibenzofuran-2-id-1-yl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 162783419 |
| Molecular Formula | C54H50N3O2Pt- |
| Molecular Weight | 968.09 g/mol |
| Exact Mass | 967.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-pyridin-2-yl-2H-dibenzofuran-2-id-1-yl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c(-c4[c-]c(-c5ccccn5)cc5oc6ccccc6c45)cccc32)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C54H50N3O2.Pt/c1-52(2,3)35-25-26-44(39(30-35)33-18-11-10-12-19-33)57-45-23-17-21-37(49(45)56-51(57)41-31-36(53(4,5)6)32-42(50(41)58)54(7,8)9)40-28-34(43-22-15-16-27-55-43)29-47-48(40)38-20-13-14-24-46(38)59-47;/h10-27,29-32,58H,1-9H3;/q-1; |
| InChIKey | YICAGVGSSAXHKQ-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.09 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|