C57H56N3OPt- — CID 162783647
2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(9,9-dimethyl-2-pyridin-2-yl-3H-fluoren-3-id-4-yl)benzimidazol-2-yl]phenol;platinum (PubChem CID 162783647) has the molecular formula C57H56N3OPt- and a molecular weight of 994.17 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(9,9-dimethyl-2-pyridin-2-yl-3H-fluoren-3-id-4-yl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(9,9-dimethyl-2-pyridin-2-yl-3H-fluoren-3-id-4-yl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 162783647 |
| Molecular Formula | C57H56N3OPt- |
| Molecular Weight | 994.17 g/mol |
| Exact Mass | 993.41 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(4-tert-butyl-2-phenylphenyl)-4-(9,9-dimethyl-2-pyridin-2-yl-3H-fluoren-3-id-4-yl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c(-c4[c-]c(-c5ccccn5)cc5c4-c4ccccc4C5(C)C)cccc32)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C57H56N3O.Pt/c1-54(2,3)37-27-28-48(41(32-37)35-20-13-12-14-21-35)60-49-26-19-23-39(51(49)59-53(60)43-33-38(55(4,5)6)34-46(52(43)61)56(7,8)9)42-30-36(47-25-17-18-29-58-47)31-45-50(42)40-22-15-16-24-44(40)57(45,10)11;/h12-29,31-34,61H,1-11H3;/q-1; |
| InChIKey | RNEBQRQDMKWUSJ-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.17 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|