C62H62N3OPt- — CID 164796582
CID 164796582 (PubChem CID 164796582) has the molecular formula C62H62N3OPt- and a molecular weight of 1060.28 g/mol.
| Compound Name | CID 164796582 |
|---|---|
| PubChem CID | 164796582 |
| Molecular Formula | C62H62N3OPt- |
| Molecular Weight | 1060.28 g/mol |
| Exact Mass | 1059.45 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc3c4c(ccc32)C(C)(C)C2=C4c3[c-]c(-c4cc(-c5ccccc5)ccn4)ccc3C2(C)C)c(-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C62H62N3O.Pt/c1-58(2,3)41-25-28-50(43(34-41)38-22-18-15-19-23-38)65-51-29-27-47-53(54(51)64-57(65)45-35-42(59(4,5)6)36-48(55(45)66)60(7,8)9)52-44-32-40(24-26-46(44)61(10,11)56(52)62(47,12)13)49-33-39(30-31-63-49)37-20-16-14-17-21-37;/h14-31,33-36,66H,1-13H3;/q-1; |
| InChIKey | QCVDEZWGUCSIMN-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.28 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|