C57H47N4OPt- — CID 164746164
2,4-ditert-butyl-6-[3-(2,4-diphenylphenyl)-10-(4-phenyl-2-pyridinyl)-11H-imidazo[4,5-a]phenanthridin-11-id-2-yl]phenol;platinum (PubChem CID 164746164) has the molecular formula C57H47N4OPt- and a molecular weight of 999.11 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-(2,4-diphenylphenyl)-10-(4-phenyl-2-pyridinyl)-11H-imidazo[4,5-a]phenanthridin-11-id-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[3-(2,4-diphenylphenyl)-10-(4-phenyl-2-pyridinyl)-11H-imidazo[4,5-a]phenanthridin-11-id-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164746164 |
| Molecular Formula | C57H47N4OPt- |
| Molecular Weight | 999.11 g/mol |
| Exact Mass | 998.34 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-(2,4-diphenylphenyl)-10-(4-phenyl-2-pyridinyl)-11H-imidazo[4,5-a]phenanthridin-11-id-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc3c4c(ccc3n2-c2ccc(-c3ccccc3)cc2-c2ccccc2)ncc2ccc(-c3cc(-c5ccccc5)ccn3)[c-]c24)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C57H47N4O.Pt/c1-56(2,3)43-33-46(54(62)47(34-43)57(4,5)6)55-60-53-51(61(55)50-26-24-39(36-16-10-7-11-17-36)30-44(50)38-20-14-9-15-21-38)27-25-48-52(53)45-31-41(22-23-42(45)35-59-48)49-32-40(28-29-58-49)37-18-12-8-13-19-37;/h7-30,32-35,62H,1-6H3;/q-1; |
| InChIKey | WJINYPYTWPIOOD-UHFFFAOYSA-N |
| XLogP | 14.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.11 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|