C61H52N3O2Pt- — CID 164796492
CID 164796492 (PubChem CID 164796492) has the molecular formula C61H52N3O2Pt- and a molecular weight of 1054.18 g/mol.
| Compound Name | CID 164796492 |
|---|---|
| PubChem CID | 164796492 |
| Molecular Formula | C61H52N3O2Pt- |
| Molecular Weight | 1054.18 g/mol |
| Exact Mass | 1053.37 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2nc3c4c5c(oc4ccc3n2-c2ccc(-c3ccccc3)cc2-c2ccccc2)C(C)(C)c2ccc(-c3cc(-c4ccccc4)ccn3)[c-]c2-5)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C61H52N3O2.Pt/c1-59(2,3)43-35-46(56(65)48(36-43)60(4,5)6)58-63-55-51(64(58)50-27-25-40(37-18-12-9-13-19-37)32-44(50)39-22-16-11-17-23-39)28-29-52-54(55)53-45-33-42(24-26-47(45)61(7,8)57(53)66-52)49-34-41(30-31-62-49)38-20-14-10-15-21-38;/h9-32,34-36,65H,1-8H3;/q-1; |
| InChIKey | WCUVTUFSLHRBJC-UHFFFAOYSA-N |
| XLogP | 15.91 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.18 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|