C32H20N4O — CID 166562274
19-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaen-3-ol (PubChem CID 166562274) has the molecular formula C32H20N4O and a molecular weight of 476.54 g/mol. Its IUPAC name is 19-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaen-3-ol.
| Compound Name | 19-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaen-3-ol |
|---|---|
| PubChem CID | 166562274 |
| Molecular Formula | C32H20N4O |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 19-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaen-3-ol |
| SMILES | Oc1cccc2c3ccccc3n3c4cccc(-[n+]5[c-]n(-c6ccccc6)c6ccccc65)c4nc3c12 |
| InChI | InChI=1S/C32H20N4O/c37-29-19-8-13-23-22-12-4-5-14-24(22)36-28-18-9-17-27(31(28)33-32(36)30(23)29)35-20-34(21-10-2-1-3-11-21)25-15-6-7-16-26(25)35/h1-19,37H |
| InChIKey | IMKLVYRXLRGCQJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|