C34H19N5OPt-2 — CID 166570663
CID 166570663 (PubChem CID 166570663) has the molecular formula C34H19N5OPt-2 and a molecular weight of 708.64 g/mol.
| Compound Name | CID 166570663 |
|---|---|
| PubChem CID | 166570663 |
| Molecular Formula | C34H19N5OPt-2 |
| Molecular Weight | 708.64 g/mol |
| Exact Mass | 708.12 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c2cccc1-c1cn3c4ccccc4n(c3n1)-c1ccccc1-[n+]1[c-]n(c3ccccc31)-c1[c-]c(ccc1)O2 |
| InChI | InChI=1S/C34H19N5O.Pt/c1-2-14-29-28(13-1)37-22-38(29)31-16-4-6-18-33(31)39-32-17-5-3-15-30(32)36-21-27(35-34(36)39)23-9-7-11-25(19-23)40-26-12-8-10-24(37)20-26;/h1-18,21H;/q-2; |
| InChIKey | RSWXEHABYNOHBQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|