C46H31BN5OPt+ — CID 164729115
2-[3,4-diphenyl-9-[3-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]imidazo[4,5-b][1,4]benzazaborinin-2-yl]phenol;platinum(2+) (PubChem CID 164729115) has the molecular formula C46H31BN5OPt+ and a molecular weight of 875.68 g/mol. Its IUPAC name is 2-[3,4-diphenyl-9-[3-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]imidazo[4,5-b][1,4]benzazaborinin-2-yl]phenol;platinum(2+).
| Compound Name | 2-[3,4-diphenyl-9-[3-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]imidazo[4,5-b][1,4]benzazaborinin-2-yl]phenol;platinum(2+) |
|---|---|
| PubChem CID | 164729115 |
| Molecular Formula | C46H31BN5OPt+ |
| Molecular Weight | 875.68 g/mol |
| Exact Mass | 875.23 |
| IUPAC Name | 2-[3,4-diphenyl-9-[3-(3-phenyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]imidazo[4,5-b][1,4]benzazaborinin-2-yl]phenol;platinum(2+) |
| SMILES | Oc1ccccc1-c1nc2c(n1-c1ccccc1)N(c1ccccc1)c1ccccc1B2c1[c-]c(-n2[c-][n+](-c3ccccc3)c3ccccc32)ccc1.[Pt+2] |
| InChI | InChI=1S/C46H31BN5O.Pt/c53-43-30-15-10-25-38(43)45-48-44-46(52(45)36-22-8-3-9-23-36)51(35-20-6-2-7-21-35)40-27-12-11-26-39(40)47(44)33-17-16-24-37(31-33)50-32-49(34-18-4-1-5-19-34)41-28-13-14-29-42(41)50;/h1-30,53H;/q-1;+2 |
| InChIKey | ZEYMXRVOSJNPBJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 50.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|