C40H32N3PtSi+ — CID 171732700
10,10-dimethyl-5-phenyl-4H-benzo[b][1,4]benzazasilin-4-ide;1-(4-methylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;platinum(4+) (PubChem CID 171732700) has the molecular formula C40H32N3PtSi+ and a molecular weight of 777.88 g/mol. Its IUPAC name is 10,10-dimethyl-5-phenyl-4H-benzo[b][1,4]benzazasilin-4-ide;1-(4-methylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;platinum(4+).
| Compound Name | 10,10-dimethyl-5-phenyl-4H-benzo[b][1,4]benzazasilin-4-ide;1-(4-methylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;platinum(4+) |
|---|---|
| PubChem CID | 171732700 |
| Molecular Formula | C40H32N3PtSi+ |
| Molecular Weight | 777.88 g/mol |
| Exact Mass | 777.20 |
| IUPAC Name | 10,10-dimethyl-5-phenyl-4H-benzo[b][1,4]benzazasilin-4-ide;1-(4-methylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;platinum(4+) |
| SMILES | C[Si]1(C)c2ccc[c-]c2N(c2[c-]cccc2)c2ccccc21.Cc1ccc(-[n+]2[c-]n(-c3[c-]cccc3)c3ccccc32)cc1.[Pt+4] |
| InChI | InChI=1S/C20H15N2.C20H17NSi.Pt/c1-16-11-13-18(14-12-16)22-15-21(17-7-3-2-4-8-17)19-9-5-6-10-20(19)22;1-22(2)19-14-8-6-12-17(19)21(16-10-4-3-5-11-16)18-13-7-9-15-20(18)22;/h2-7,9-14H,1H3;3-10,12,14-15H,1-2H3;/q-1;-2;+4 |
| InChIKey | CPNLXMMEYKZFCQ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.88 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|