C44H36BN2Pt+ — CID 171732590
CID 171732590 (PubChem CID 171732590) has the molecular formula C44H36BN2Pt+ and a molecular weight of 798.68 g/mol.
| Compound Name | CID 171732590 |
|---|---|
| PubChem CID | 171732590 |
| Molecular Formula | C44H36BN2Pt+ |
| Molecular Weight | 798.68 g/mol |
| Exact Mass | 798.26 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccc[c-]c2B2c3[c-]cccc3C(C)(C)c3cccc1c32.Cc1ccc(-[n+]2[c-]n(-c3[c-]cccc3)c3ccccc32)cc1.[Pt+4] |
| InChI | InChI=1S/C24H21B.C20H15N2.Pt/c1-23(2)16-10-5-7-14-20(16)25-21-15-8-6-11-17(21)24(3,4)19-13-9-12-18(23)22(19)25;1-16-11-13-18(14-12-16)22-15-21(17-7-3-2-4-8-17)19-9-5-6-10-20(19)22;/h5-13H,1-4H3;2-7,9-14H,1H3;/q-2;-1;+4 |
| InChIKey | RKHBSLVWOKHNBF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|