C38H24N3OPt+ — CID 171732605
CID 171732605 (PubChem CID 171732605) has the molecular formula C38H24N3OPt+ and a molecular weight of 733.71 g/mol.
| Compound Name | CID 171732605 |
|---|---|
| PubChem CID | 171732605 |
| Molecular Formula | C38H24N3OPt+ |
| Molecular Weight | 733.71 g/mol |
| Exact Mass | 733.16 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-[n+]2[c-]n(-c3[c-]cccc3)c3ccccc32)cc1.[Pt+4].[c-]1cccc2c1-n1c3[c-]cccc3c3cccc(c31)O2 |
| InChI | InChI=1S/C20H15N2.C18H9NO.Pt/c1-16-11-13-18(14-12-16)22-15-21(17-7-3-2-4-8-17)19-9-5-6-10-20(19)22;1-2-8-14-12(6-1)13-7-5-11-17-18(13)19(14)15-9-3-4-10-16(15)20-17;/h2-7,9-14H,1H3;1-7,10-11H;/q-1;-2;+4 |
| InChIKey | SYQYNUJYIIROMN-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 22.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.71 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|