C50H34BN4Pt+ — CID 171732575
CID 171732575 (PubChem CID 171732575) has the molecular formula C50H34BN4Pt+ and a molecular weight of 896.74 g/mol.
| Compound Name | CID 171732575 |
|---|---|
| PubChem CID | 171732575 |
| Molecular Formula | C50H34BN4Pt+ |
| Molecular Weight | 896.74 g/mol |
| Exact Mass | 896.25 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-[n+]2[c-]n(-c3[c-]cccc3)c3ccccc32)cc1.[Pt+4].[c-]1cccc2c1B1c3[c-]cccc3N(c3ccccc3)c3cccc(c31)N2c1ccccc1 |
| InChI | InChI=1S/C30H19BN2.C20H15N2.Pt/c1-3-12-22(13-4-1)32-26-18-9-7-16-24(26)31-25-17-8-10-19-27(25)33(23-14-5-2-6-15-23)29-21-11-20-28(32)30(29)31;1-16-11-13-18(14-12-16)22-15-21(17-7-3-2-4-8-17)19-9-5-6-10-20(19)22;/h1-15,18-21H;2-7,9-14H,1H3;/q-2;-1;+4 |
| InChIKey | RPOGGMJQDCAWPI-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.74 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|